C22H17N3OS — CID 168576801
4-[2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol (PubChem CID 168576801) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 4-[2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol.
| Compound Name | 4-[2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol |
|---|---|
| PubChem CID | 168576801 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-[2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol |
| SMILES | Oc1ccc(-c2ccccc2C=NNc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C22H17N3OS/c26-19-12-10-16(11-13-19)20-9-5-4-8-18(20)14-23-25-22-24-21(15-27-22)17-6-2-1-3-7-17/h1-15,26H,(H,24,25) |
| InChIKey | GGGUIFGYMZTWFO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|