About 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol
4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol (PubChem CID 168580110) has the molecular formula C10H8ClFN2OS
and a molecular weight of 258.70 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol.
Molecular Properties
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol |
| PubChem CID | 168580110 |
| Molecular Formula | C10H8ClFN2OS |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol |
| SMILES | Oc1ccc(NCc2cnc(Cl)s2)cc1F |
| InChI | InChI=1S/C10H8ClFN2OS/c11-10-14-5-7(16-10)4-13-6-1-2-9(15)8(12)3-6/h1-3,5,13,15H,4H2 |
| InChIKey | SATDFCDHQDFTIX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol?
The IUPAC name of 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol (CID 168580110) is 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol.
What is the SMILES notation for 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol?
The canonical SMILES for 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol is Oc1ccc(NCc2cnc(Cl)s2)cc1F.
What is the InChIKey of 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol?
The InChIKey is SATDFCDHQDFTIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClFN2OS/c11-10-14-5-7(16-10)4-13-6-1-2-9(15)8(12)3-6/h1-3,5,13,15H,4H2.
What are the key properties of 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol?
4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol has a molecular weight of 258.70 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-fluorophenol is sourced from PubChem (CID 168580110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).