C17H23ClN4S — CID 168581633
1-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-N,N-dimethylpiperidin-3-amine (PubChem CID 168581633) has the molecular formula C17H23ClN4S and a molecular weight of 350.92 g/mol. Its IUPAC name is 1-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-N,N-dimethylpiperidin-3-amine.
| Compound Name | 1-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 168581633 |
| Molecular Formula | C17H23ClN4S |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-N,N-dimethylpiperidin-3-amine |
| SMILES | CN(C)C1CCCN(c2ccc(NCc3cnc(Cl)s3)cc2)C1 |
| InChI | InChI=1S/C17H23ClN4S/c1-21(2)15-4-3-9-22(12-15)14-7-5-13(6-8-14)19-10-16-11-20-17(18)23-16/h5-8,11,15,19H,3-4,9-10,12H2,1-2H3 |
| InChIKey | RFPIUERPNBRVCA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|