About 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one
3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one (PubChem CID 168582967) has the molecular formula C15H13ClN4OS
and a molecular weight of 332.82 g/mol. Its IUPAC name is 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one |
| PubChem CID | 168582967 |
| Molecular Formula | C15H13ClN4OS |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one |
| SMILES | Cc1ccc(-c2ccc(=O)[nH]n2)cc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C15H13ClN4OS/c1-9-2-3-10(12-4-5-14(21)20-19-12)6-13(9)17-7-11-8-18-15(16)22-11/h2-6,8,17H,7H2,1H3,(H,20,21) |
| InChIKey | NIBFTJSCRSSGSV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one?
The IUPAC name of 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one (CID 168582967) is 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one.
What is the SMILES notation for 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one?
The canonical SMILES for 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one is Cc1ccc(-c2ccc(=O)[nH]n2)cc1NCc1cnc(Cl)s1.
What is the InChIKey of 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one?
The InChIKey is NIBFTJSCRSSGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4OS/c1-9-2-3-10(12-4-5-14(21)20-19-12)6-13(9)17-7-11-8-18-15(16)22-11/h2-6,8,17H,7H2,1H3,(H,20,21).
What are the key properties of 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one?
3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one has a molecular weight of 332.82 g/mol, XLogP of 3.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-methylphenyl]-1H-pyridazin-6-one is sourced from PubChem (CID 168582967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).