C14H10BrFN2O — CID 168585486
4-[2-(bromomethyl)-3-fluorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168585486) has the molecular formula C14H10BrFN2O and a molecular weight of 321.15 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3-fluorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[2-(bromomethyl)-3-fluorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585486 |
| Molecular Formula | C14H10BrFN2O |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 4-[2-(bromomethyl)-3-fluorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2cccc(F)c2CBr)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C14H10BrFN2O/c1-8-5-10(12(7-17)14(19)18-8)9-3-2-4-13(16)11(9)6-15/h2-5H,6H2,1H3,(H,18,19) |
| InChIKey | RWWLPRNWRXZDTG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|