C21H17BrN2O3 — CID 168587450
4-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168587450) has the molecular formula C21H17BrN2O3 and a molecular weight of 425.28 g/mol. Its IUPAC name is 4-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168587450 |
| Molecular Formula | C21H17BrN2O3 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 4-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(C)[nH]c(=O)c2C#N)cc1COc1cccc(Br)c1 |
| InChI | InChI=1S/C21H17BrN2O3/c1-13-8-18(19(11-23)21(25)24-13)14-6-7-20(26-2)15(9-14)12-27-17-5-3-4-16(22)10-17/h3-10H,12H2,1-2H3,(H,24,25) |
| InChIKey | YCDDUURPUNAQQN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |