C17H23N5O4S — CID 16858902
ethyl 2-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]acetate (PubChem CID 16858902) has the molecular formula C17H23N5O4S and a molecular weight of 393.47 g/mol. Its IUPAC name is ethyl 2-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 16858902 |
| Molecular Formula | C17H23N5O4S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 2-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CC1CSc2nc3c(cnn3C(C)(C)C)c(=O)n21 |
| InChI | InChI=1S/C17H23N5O4S/c1-5-26-13(24)8-18-12(23)6-10-9-27-16-20-14-11(15(25)21(10)16)7-19-22(14)17(2,3)4/h7,10H,5-6,8-9H2,1-4H3,(H,18,23) |
| InChIKey | JWJNXFGZKVNKKK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |