About 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine
2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine (PubChem CID 168591694) has the molecular formula C9H7F5N4O
and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine |
| PubChem CID | 168591694 |
| Molecular Formula | C9H7F5N4O |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc(F)c(OC(F)(F)F)c1F |
| InChI | InChI=1S/C9H7F5N4O/c10-5-2-1-4(3-17-18-8(15)16)6(11)7(5)19-9(12,13)14/h1-3H,(H4,15,16,18) |
| InChIKey | AIRICJBOXWDAAT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine?
The IUPAC name of 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine (CID 168591694) is 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine.
What is the SMILES notation for 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine?
The canonical SMILES for 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine is NC(N)=NN=Cc1ccc(F)c(OC(F)(F)F)c1F.
What is the InChIKey of 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine?
The InChIKey is AIRICJBOXWDAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F5N4O/c10-5-2-1-4(3-17-18-8(15)16)6(11)7(5)19-9(12,13)14/h1-3H,(H4,15,16,18).
What are the key properties of 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine?
2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine has a molecular weight of 282.17 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine is sourced from PubChem (CID 168591694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).