C9H7F5N4O — CID 168591694
2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine (PubChem CID 168591694) has the molecular formula C9H7F5N4O and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591694 |
| Molecular Formula | C9H7F5N4O |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc(F)c(OC(F)(F)F)c1F |
| InChI | InChI=1S/C9H7F5N4O/c10-5-2-1-4(3-17-18-8(15)16)6(11)7(5)19-9(12,13)14/h1-3H,(H4,15,16,18) |
| InChIKey | AIRICJBOXWDAAT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|