C14H20N6O — CID 168591843
2-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylideneamino]guanidine (PubChem CID 168591843) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591843 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylideneamino]guanidine |
| SMILES | CN1CCN(C(=O)c2ccc(C=NN=C(N)N)cc2)CC1 |
| InChI | InChI=1S/C14H20N6O/c1-19-6-8-20(9-7-19)13(21)12-4-2-11(3-5-12)10-17-18-14(15)16/h2-5,10H,6-9H2,1H3,(H4,15,16,18) |
| InChIKey | OKIOFVDZVDVAPP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|