C18H28N2O5 — CID 168593612
tert-butyl 3-[4-(2,3-dihydroxypropylamino)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 168593612) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl 3-[4-(2,3-dihydroxypropylamino)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(2,3-dihydroxypropylamino)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168593612 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | tert-butyl 3-[4-(2,3-dihydroxypropylamino)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(NCC(O)CO)cc2)C1 |
| InChI | InChI=1S/C18H28N2O5/c1-18(2,3)25-17(23)20-9-8-16(11-20)24-15-6-4-13(5-7-15)19-10-14(22)12-21/h4-7,14,16,19,21-22H,8-12H2,1-3H3 |
| InChIKey | MTSFOQBMPFNUHP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|