C15H16ClNO6S — CID 168595121
5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid (PubChem CID 168595121) has the molecular formula C15H16ClNO6S and a molecular weight of 373.81 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid.
| Compound Name | 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 168595121 |
| Molecular Formula | C15H16ClNO6S |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Oc2ccc(Cl)cc2)ccc1NCC(O)CO |
| InChI | InChI=1S/C15H16ClNO6S/c16-10-1-3-12(4-2-10)23-13-5-6-14(17-8-11(19)9-18)15(7-13)24(20,21)22/h1-7,11,17-19H,8-9H2,(H,20,21,22) |
| InChIKey | ILMCEXXERLCWKS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|