About 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid
5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid (PubChem CID 168595121) has the molecular formula C15H16ClNO6S
and a molecular weight of 373.81 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid.
Molecular Properties
| Compound Name | 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid |
| PubChem CID | 168595121 |
| Molecular Formula | C15H16ClNO6S |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Oc2ccc(Cl)cc2)ccc1NCC(O)CO |
| InChI | InChI=1S/C15H16ClNO6S/c16-10-1-3-12(4-2-10)23-13-5-6-14(17-8-11(19)9-18)15(7-13)24(20,21)22/h1-7,11,17-19H,8-9H2,(H,20,21,22) |
| InChIKey | ILMCEXXERLCWKS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid?
The IUPAC name of 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid (CID 168595121) is 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid.
What is the SMILES notation for 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid?
The canonical SMILES for 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid is O=S(=O)(O)c1cc(Oc2ccc(Cl)cc2)ccc1NCC(O)CO.
What is the InChIKey of 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid?
The InChIKey is ILMCEXXERLCWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO6S/c16-10-1-3-12(4-2-10)23-13-5-6-14(17-8-11(19)9-18)15(7-13)24(20,21)22/h1-7,11,17-19H,8-9H2,(H,20,21,22).
What are the key properties of 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid?
5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid has a molecular weight of 373.81 g/mol, XLogP of 2.14, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenoxy)-2-(2,3-dihydroxypropylamino)benzenesulfonic acid is sourced from PubChem (CID 168595121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).