C15H14Cl2N2O5S — CID 168595225
3,6-dichloro-8-(2,3-dihydroxypropylamino)-9H-carbazole-1-sulfonic acid (PubChem CID 168595225) has the molecular formula C15H14Cl2N2O5S and a molecular weight of 405.26 g/mol. Its IUPAC name is 3,6-dichloro-8-(2,3-dihydroxypropylamino)-9H-carbazole-1-sulfonic acid.
| Compound Name | 3,6-dichloro-8-(2,3-dihydroxypropylamino)-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 168595225 |
| Molecular Formula | C15H14Cl2N2O5S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 3,6-dichloro-8-(2,3-dihydroxypropylamino)-9H-carbazole-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Cl)cc2c1[nH]c1c(NCC(O)CO)cc(Cl)cc12 |
| InChI | InChI=1S/C15H14Cl2N2O5S/c16-7-1-10-11-2-8(17)4-13(25(22,23)24)15(11)19-14(10)12(3-7)18-5-9(21)6-20/h1-4,9,18-21H,5-6H2,(H,22,23,24) |
| InChIKey | WPWIQOUQOIWMTJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|