About 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one
6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one (PubChem CID 168595615) has the molecular formula C11H12ClNO4
and a molecular weight of 257.67 g/mol. Its IUPAC name is 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one |
| PubChem CID | 168595615 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2ccc(Cl)c(NCC(O)CO)c21 |
| InChI | InChI=1S/C11H12ClNO4/c12-8-2-1-6-5-17-11(16)9(6)10(8)13-3-7(15)4-14/h1-2,7,13-15H,3-5H2 |
| InChIKey | JILKDJJNWYKZSX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one?
The IUPAC name of 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one (CID 168595615) is 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one.
What is the SMILES notation for 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one?
The canonical SMILES for 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one is O=C1OCc2ccc(Cl)c(NCC(O)CO)c21.
What is the InChIKey of 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one?
The InChIKey is JILKDJJNWYKZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO4/c12-8-2-1-6-5-17-11(16)9(6)10(8)13-3-7(15)4-14/h1-2,7,13-15H,3-5H2.
What are the key properties of 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one?
6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one has a molecular weight of 257.67 g/mol, XLogP of 0.78, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-(2,3-dihydroxypropylamino)-3H-2-benzofuran-1-one is sourced from PubChem (CID 168595615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).