C14H20N2O3 — CID 168595777
6-(2,3-dihydroxypropylamino)-1,3,3-trimethylindol-2-one (PubChem CID 168595777) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylamino)-1,3,3-trimethylindol-2-one.
| Compound Name | 6-(2,3-dihydroxypropylamino)-1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 168595777 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 6-(2,3-dihydroxypropylamino)-1,3,3-trimethylindol-2-one |
| SMILES | CN1C(=O)C(C)(C)c2ccc(NCC(O)CO)cc21 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2)11-5-4-9(15-7-10(18)8-17)6-12(11)16(3)13(14)19/h4-6,10,15,17-18H,7-8H2,1-3H3 |
| InChIKey | IMIQXIPHMSZUFG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |