About 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol
3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol (PubChem CID 168596141) has the molecular formula C12H16BrNO4
and a molecular weight of 318.17 g/mol. Its IUPAC name is 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol |
| PubChem CID | 168596141 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cc(Br)cc(C2OCCO2)c1 |
| InChI | InChI=1S/C12H16BrNO4/c13-9-3-8(12-17-1-2-18-12)4-10(5-9)14-6-11(16)7-15/h3-5,11-12,14-16H,1-2,6-7H2 |
| InChIKey | DLGANPSVDUUBJG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol?
The IUPAC name of 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol (CID 168596141) is 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol.
What is the SMILES notation for 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol?
The canonical SMILES for 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol is OCC(O)CNc1cc(Br)cc(C2OCCO2)c1.
What is the InChIKey of 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol?
The InChIKey is DLGANPSVDUUBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO4/c13-9-3-8(12-17-1-2-18-12)4-10(5-9)14-6-11(16)7-15/h3-5,11-12,14-16H,1-2,6-7H2.
What are the key properties of 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol?
3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol has a molecular weight of 318.17 g/mol, XLogP of 1.26, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-bromo-5-(1,3-dioxolan-2-yl)anilino]propane-1,2-diol is sourced from PubChem (CID 168596141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).