C15H19N3O4 — CID 168596967
2-[4-(2,3-dihydroxypropylamino)phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 168596967) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroxypropylamino)phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-[4-(2,3-dihydroxypropylamino)phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 168596967 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[4-(2,3-dihydroxypropylamino)phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1C2CCCN2C(=O)N1c1ccc(NCC(O)CO)cc1 |
| InChI | InChI=1S/C15H19N3O4/c19-9-12(20)8-16-10-3-5-11(6-4-10)18-14(21)13-2-1-7-17(13)15(18)22/h3-6,12-13,16,19-20H,1-2,7-9H2 |
| InChIKey | XEVQSQNTOYVGSQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|