C17H18F2O5 — CID 168598088
5-[(4-butoxy-3,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168598088) has the molecular formula C17H18F2O5 and a molecular weight of 340.32 g/mol. Its IUPAC name is 5-[(4-butoxy-3,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-butoxy-3,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598088 |
| Molecular Formula | C17H18F2O5 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 5-[(4-butoxy-3,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCOc1c(F)cc(C=C2C(=O)OC(C)(C)OC2=O)cc1F |
| InChI | InChI=1S/C17H18F2O5/c1-4-5-6-22-14-12(18)8-10(9-13(14)19)7-11-15(20)23-17(2,3)24-16(11)21/h7-9H,4-6H2,1-3H3 |
| InChIKey | IARIBMSHGVVWFQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|