C15H12F4O4 — CID 168599181
5-[[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599181) has the molecular formula C15H12F4O4 and a molecular weight of 332.25 g/mol. Its IUPAC name is 5-[[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599181 |
| Molecular Formula | C15H12F4O4 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-[[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1c(F)ccc(C=C2C(=O)OC(C)(C)OC2=O)c1C(F)(F)F |
| InChI | InChI=1S/C15H12F4O4/c1-7-10(16)5-4-8(11(7)15(17,18)19)6-9-12(20)22-14(2,3)23-13(9)21/h4-6H,1-3H3 |
| InChIKey | NURXQEUZCXJSMF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|