C23H22O8 — CID 168599325
3-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]-4-methoxybenzaldehyde (PubChem CID 168599325) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is 3-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 168599325 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1COc1ccc(C=C2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C23H22O8/c1-23(2)30-21(25)17(22(26)31-23)10-14-5-8-19(20(11-14)28-4)29-13-16-9-15(12-24)6-7-18(16)27-3/h5-12H,13H2,1-4H3 |
| InChIKey | WHCOQVPKDLFVSX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|