C15H23N7O — CID 168602241
3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(3-methylpiperidin-1-yl)benzamide (PubChem CID 168602241) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(3-methylpiperidin-1-yl)benzamide.
| Compound Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(3-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 168602241 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(3-methylpiperidin-1-yl)benzamide |
| SMILES | CC1CCCN(c2ccc(C(N)=O)cc2/N=C(\N)N=C(N)N)C1 |
| InChI | InChI=1S/C15H23N7O/c1-9-3-2-6-22(8-9)12-5-4-10(13(16)23)7-11(12)20-15(19)21-14(17)18/h4-5,7,9H,2-3,6,8H2,1H3,(H2,16,23)(H6,17,18,19,20,21) |
| InChIKey | GHULCPAWZVDRMQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|