About 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine
2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168603134) has the molecular formula C8H7BrClF2N5
and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine.
Molecular Properties
| Compound Name | 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine |
| PubChem CID | 168603134 |
| Molecular Formula | C8H7BrClF2N5 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N\c1c(Cl)cc(F)c(F)c1Br |
| InChI | InChI=1S/C8H7BrClF2N5/c9-4-5(12)3(11)1-2(10)6(4)16-8(15)17-7(13)14/h1H,(H6,13,14,15,16,17) |
| InChIKey | YLOOTRQXGYTIQI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine?
The IUPAC name of 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine (CID 168603134) is 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine.
What is the SMILES notation for 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine?
The canonical SMILES for 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine is NC(N)=N/C(N)=N\c1c(Cl)cc(F)c(F)c1Br.
What is the InChIKey of 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine?
The InChIKey is YLOOTRQXGYTIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClF2N5/c9-4-5(12)3(11)1-2(10)6(4)16-8(15)17-7(13)14/h1H,(H6,13,14,15,16,17).
What are the key properties of 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine?
2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine has a molecular weight of 326.53 g/mol, XLogP of 1.60, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-6-chloro-3,4-difluorophenyl)-1-(diaminomethylidene)guanidine is sourced from PubChem (CID 168603134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).