C15H19N5O3 — CID 168603538
1-(diaminomethylidene)-2-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]guanidine (PubChem CID 168603538) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 168603538 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-ethoxy-5-[5-(hydroxymethyl)furan-2-yl]phenyl]guanidine |
| SMILES | CCOc1ccc(-c2ccc(CO)o2)cc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C15H19N5O3/c1-2-22-13-5-3-9(12-6-4-10(8-21)23-12)7-11(13)19-15(18)20-14(16)17/h3-7,21H,2,8H2,1H3,(H6,16,17,18,19,20) |
| InChIKey | ILRWVXCYHGPDMP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|