C11H14F3N5O — CID 168604353
1-(diaminomethylidene)-2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]guanidine (PubChem CID 168604353) has the molecular formula C11H14F3N5O and a molecular weight of 289.26 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 168604353 |
| Molecular Formula | C11H14F3N5O |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3N5O/c12-11(13,14)6-20-5-7-1-3-8(4-2-7)18-10(17)19-9(15)16/h1-4H,5-6H2,(H6,15,16,17,18,19) |
| InChIKey | QKOQVJFUPKVHIR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|