C10H10I2N6 — CID 168604546
2-(4-cyano-2,6-diiodo-3-methylphenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168604546) has the molecular formula C10H10I2N6 and a molecular weight of 468.04 g/mol. Its IUPAC name is 2-(4-cyano-2,6-diiodo-3-methylphenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(4-cyano-2,6-diiodo-3-methylphenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604546 |
| Molecular Formula | C10H10I2N6 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.91 |
| IUPAC Name | 2-(4-cyano-2,6-diiodo-3-methylphenyl)-1-(diaminomethylidene)guanidine |
| SMILES | Cc1c(C#N)cc(I)c(/N=C(/N)N=C(N)N)c1I |
| InChI | InChI=1S/C10H10I2N6/c1-4-5(3-13)2-6(11)8(7(4)12)17-10(16)18-9(14)15/h2H,1H3,(H6,14,15,16,17,18) |
| InChIKey | GVKMPRQEXQJLTC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|