C18H18N6S — CID 168604957
1-(diaminomethylidene)-2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]guanidine (PubChem CID 168604957) has the molecular formula C18H18N6S and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 168604957 |
| Molecular Formula | C18H18N6S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]guanidine |
| SMILES | Cc1ccc(-c2csc(-c3cccc(/N=C(\N)N=C(N)N)c3)n2)cc1 |
| InChI | InChI=1S/C18H18N6S/c1-11-5-7-12(8-6-11)15-10-25-16(23-15)13-3-2-4-14(9-13)22-18(21)24-17(19)20/h2-10H,1H3,(H6,19,20,21,22,24) |
| InChIKey | BJODDCNOOQBYDX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|