C14H10F5N5S — CID 168605059
1-(diaminomethylidene)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]guanidine (PubChem CID 168605059) has the molecular formula C14H10F5N5S and a molecular weight of 375.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]guanidine |
|---|---|
| PubChem CID | 168605059 |
| Molecular Formula | C14H10F5N5S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(Sc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H10F5N5S/c15-7-8(16)10(18)12(11(19)9(7)17)25-6-3-1-5(2-4-6)23-14(22)24-13(20)21/h1-4H,(H6,20,21,22,23,24) |
| InChIKey | QFWUELRLTKDBGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|