C14H20N6O2 — CID 168605232
1-(diaminomethylidene)-2-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]guanidine (PubChem CID 168605232) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 168605232 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(OCC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C14H20N6O2/c15-13(16)19-14(17)18-10-3-5-11(6-4-10)22-9-12(21)20-7-1-2-8-20/h3-6H,1-2,7-9H2,(H6,15,16,17,18,19) |
| InChIKey | KHNGBUUIIXVNPL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|