C10H11N7O2 — CID 168605495
1-(diaminomethylidene)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]guanidine (PubChem CID 168605495) has the molecular formula C10H11N7O2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168605495 |
| Molecular Formula | C10H11N7O2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C10H11N7O2/c11-8(12)16-9(13)14-6-3-1-5(2-4-6)7-15-10(18)19-17-7/h1-4H,(H,15,17,18)(H6,11,12,13,14,16) |
| InChIKey | XVBPNNBOUONXRO-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|