C19H13F3N6 — CID 168608075
2-[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608075) has the molecular formula C19H13F3N6 and a molecular weight of 382.35 g/mol. Its IUPAC name is 2-[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608075 |
| Molecular Formula | C19H13F3N6 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CN(C)c1cc(C(F)(F)F)cc(-c2ccc(NC(C#N)=C(C#N)C#N)cc2)n1 |
| InChI | InChI=1S/C19H13F3N6/c1-28(2)18-8-14(19(20,21)22)7-16(27-18)12-3-5-15(6-4-12)26-17(11-25)13(9-23)10-24/h3-8,26H,1-2H3 |
| InChIKey | LNRKEUNOQWCOEZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|