C16H13N5O3 — CID 168608495
2-acetamido-3-[4-(1,2,2-tricyanoethenylamino)phenyl]propanoic acid (PubChem CID 168608495) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2-acetamido-3-[4-(1,2,2-tricyanoethenylamino)phenyl]propanoic acid.
| Compound Name | 2-acetamido-3-[4-(1,2,2-tricyanoethenylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 168608495 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-acetamido-3-[4-(1,2,2-tricyanoethenylamino)phenyl]propanoic acid |
| SMILES | CC(=O)NC(Cc1ccc(NC(C#N)=C(C#N)C#N)cc1)C(=O)O |
| InChI | InChI=1S/C16H13N5O3/c1-10(22)20-14(16(23)24)6-11-2-4-13(5-3-11)21-15(9-19)12(7-17)8-18/h2-5,14,21H,6H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | UPWACVZAJUQPHB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|