C19H12ClF3N6 — CID 168608658
2-[3-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608658) has the molecular formula C19H12ClF3N6 and a molecular weight of 416.79 g/mol. Its IUPAC name is 2-[3-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608658 |
| Molecular Formula | C19H12ClF3N6 |
| Molecular Weight | 416.79 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[3-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc(Cl)c1-n1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C19H12ClF3N6/c20-13-5-3-6-14(27-15(10-26)11(8-24)9-25)17(13)29-16-7-2-1-4-12(16)18(28-29)19(21,22)23/h3,5-6,27H,1-2,4,7H2 |
| InChIKey | YGHZBRLXVZGBER-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|