C12H3F4IN4 — CID 168608727
2-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608727) has the molecular formula C12H3F4IN4 and a molecular weight of 406.08 g/mol. Its IUPAC name is 2-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608727 |
| Molecular Formula | C12H3F4IN4 |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 2-[5-fluoro-2-iodo-3-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(F)cc(C(F)(F)F)c1I |
| InChI | InChI=1S/C12H3F4IN4/c13-7-1-8(12(14,15)16)11(17)9(2-7)21-10(5-20)6(3-18)4-19/h1-2,21H |
| InChIKey | JQOGQMKXWMLZBL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|