C17H15N5O — CID 168609092
N-cyclopentyl-4-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168609092) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is N-cyclopentyl-4-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-cyclopentyl-4-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168609092 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-cyclopentyl-4-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C17H15N5O/c18-9-13(10-19)16(11-20)21-15-7-5-12(6-8-15)17(23)22-14-3-1-2-4-14/h5-8,14,21H,1-4H2,(H,22,23) |
| InChIKey | PJUMHCRTXVSUJE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|