C20H16N6OS — CID 168609131
2-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609131) has the molecular formula C20H16N6OS and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609131 |
| Molecular Formula | C20H16N6OS |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C20H16N6OS/c21-12-15(13-22)18(14-23)24-16-3-5-17(6-4-16)25-7-9-26(10-8-25)20(27)19-2-1-11-28-19/h1-6,11,24H,7-10H2 |
| InChIKey | GVLDTOKSUDEAKL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|