C22H11N7O2 — CID 168609499
2-[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609499) has the molecular formula C22H11N7O2 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609499 |
| Molecular Formula | C22H11N7O2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc2cc(-n3cnc(-c4ccccc4)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H11N7O2/c23-10-16(11-24)18(12-25)27-17-7-6-15-8-19(22(30)31-20(15)9-17)29-13-26-21(28-29)14-4-2-1-3-5-14/h1-9,13,27H |
| InChIKey | OGNSIWVDYPUYOB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|