C12H4Br2N6 — CID 168609630
2-[(4,6-dibromo-1H-benzimidazol-5-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609630) has the molecular formula C12H4Br2N6 and a molecular weight of 392.01 g/mol. Its IUPAC name is 2-[(4,6-dibromo-1H-benzimidazol-5-yl)amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[(4,6-dibromo-1H-benzimidazol-5-yl)amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609630 |
| Molecular Formula | C12H4Br2N6 |
| Molecular Weight | 392.01 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | 2-[(4,6-dibromo-1H-benzimidazol-5-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(Br)cc2[nH]cnc2c1Br |
| InChI | InChI=1S/C12H4Br2N6/c13-7-1-8-12(19-5-18-8)10(14)11(7)20-9(4-17)6(2-15)3-16/h1,5,20H,(H,18,19) |
| InChIKey | QFVGFQFYTHGFCY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.01 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|