C19H11N7O2 — CID 168609777
1-methyl-4-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[3,4-b]pyridine-3-carboxylic acid (PubChem CID 168609777) has the molecular formula C19H11N7O2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-methyl-4-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[3,4-b]pyridine-3-carboxylic acid.
| Compound Name | 1-methyl-4-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[3,4-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168609777 |
| Molecular Formula | C19H11N7O2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-methyl-4-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[3,4-b]pyridine-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)c2c(-c3ccc(NC(C#N)=C(C#N)C#N)cc3)ccnc21 |
| InChI | InChI=1S/C19H11N7O2/c1-26-18-16(17(25-26)19(27)28)14(6-7-23-18)11-2-4-13(5-3-11)24-15(10-22)12(8-20)9-21/h2-7,24H,1H3,(H,27,28) |
| InChIKey | AJZJBSAPUPSHCH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 151.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|