C19H11F3N4O — CID 168609850
2-[2-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609850) has the molecular formula C19H11F3N4O and a molecular weight of 368.32 g/mol. Its IUPAC name is 2-[2-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609850 |
| Molecular Formula | C19H11F3N4O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[2-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1cc(Oc2ccc(C(F)(F)F)cc2)ccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C19H11F3N4O/c1-12-8-16(27-15-4-2-14(3-5-15)19(20,21)22)6-7-17(12)26-18(11-25)13(9-23)10-24/h2-8,26H,1H3 |
| InChIKey | QBVINYHDXMRGOY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|