C13H7FN4O2 — CID 168609856
[4-fluoro-3-(1,2,2-tricyanoethenylamino)phenyl] acetate (PubChem CID 168609856) has the molecular formula C13H7FN4O2 and a molecular weight of 270.22 g/mol. Its IUPAC name is [4-fluoro-3-(1,2,2-tricyanoethenylamino)phenyl] acetate.
| Compound Name | [4-fluoro-3-(1,2,2-tricyanoethenylamino)phenyl] acetate |
|---|---|
| PubChem CID | 168609856 |
| Molecular Formula | C13H7FN4O2 |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [4-fluoro-3-(1,2,2-tricyanoethenylamino)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(F)c(NC(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C13H7FN4O2/c1-8(19)20-10-2-3-11(14)12(4-10)18-13(7-17)9(5-15)6-16/h2-4,18H,1H3 |
| InChIKey | NTBGPJDKXADSPO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|