C14H10N6O — CID 168610026
2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168610026) has the molecular formula C14H10N6O and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610026 |
| Molecular Formula | C14H10N6O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | CN1C(=O)NCc2c(NC(C#N)=C(C#N)C#N)cccc21 |
| InChI | InChI=1S/C14H10N6O/c1-20-13-4-2-3-11(10(13)8-18-14(20)21)19-12(7-17)9(5-15)6-16/h2-4,19H,8H2,1H3,(H,18,21) |
| InChIKey | IMCQCMYGQVGYHO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|