C15H13N5 — CID 168610429
2-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168610429) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610429 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC1CCc2cc(NC(C#N)=C(C#N)C#N)ccc2N1 |
| InChI | InChI=1S/C15H13N5/c1-10-2-3-11-6-13(4-5-14(11)19-10)20-15(9-18)12(7-16)8-17/h4-6,10,19-20H,2-3H2,1H3 |
| InChIKey | XXKOXLXGEUTKPE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|