C12H6F2N4O — CID 168610432
2-[2,3-difluoro-6-(hydroxymethyl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168610432) has the molecular formula C12H6F2N4O and a molecular weight of 260.20 g/mol. Its IUPAC name is 2-[2,3-difluoro-6-(hydroxymethyl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2,3-difluoro-6-(hydroxymethyl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610432 |
| Molecular Formula | C12H6F2N4O |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-[2,3-difluoro-6-(hydroxymethyl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(CO)ccc(F)c1F |
| InChI | InChI=1S/C12H6F2N4O/c13-9-2-1-7(6-19)12(11(9)14)18-10(5-17)8(3-15)4-16/h1-2,18-19H,6H2 |
| InChIKey | KLCORRPZIZDSIO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|