About benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate
benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 168612506) has the molecular formula C15H11BrF3N3S
and a molecular weight of 402.24 g/mol. Its IUPAC name is benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate |
| PubChem CID | 168612506 |
| Molecular Formula | C15H11BrF3N3S |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1c(F)cc(Br)c(F)c1F)SCc1ccccc1 |
| InChI | InChI=1S/C15H11BrF3N3S/c16-11-6-12(17)10(13(18)14(11)19)7-21-22-15(20)23-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,20,22) |
| InChIKey | NVLPVMOFSOEJDJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate?
The IUPAC name of benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate (CID 168612506) is benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate.
What is the SMILES notation for benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate?
The canonical SMILES for benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate is NC(=NN=Cc1c(F)cc(Br)c(F)c1F)SCc1ccccc1.
What is the InChIKey of benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate?
The InChIKey is NVLPVMOFSOEJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrF3N3S/c16-11-6-12(17)10(13(18)14(11)19)7-21-22-15(20)23-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,20,22).
What are the key properties of benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate?
benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate has a molecular weight of 402.24 g/mol, XLogP of 4.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N'-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]carbamimidothioate is sourced from PubChem (CID 168612506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).