C18H15ClN4S — CID 168613286
benzyl N'-[(6-chloroquinolin-8-yl)methylideneamino]carbamimidothioate (PubChem CID 168613286) has the molecular formula C18H15ClN4S and a molecular weight of 354.87 g/mol. Its IUPAC name is benzyl N'-[(6-chloroquinolin-8-yl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(6-chloroquinolin-8-yl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613286 |
| Molecular Formula | C18H15ClN4S |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | benzyl N'-[(6-chloroquinolin-8-yl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Cl)cc2cccnc12)SCc1ccccc1 |
| InChI | InChI=1S/C18H15ClN4S/c19-16-9-14-7-4-8-21-17(14)15(10-16)11-22-23-18(20)24-12-13-5-2-1-3-6-13/h1-11H,12H2,(H2,20,23) |
| InChIKey | CMAZOOWORVPRGY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|