C17H19N5OS — CID 168618652
N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618652) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618652 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[[4-ethoxy-3-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(C=NNc2nc(C)cs2)cc1Cn1cccn1 |
| InChI | InChI=1S/C17H19N5OS/c1-3-23-16-6-5-14(9-15(16)11-22-8-4-7-19-22)10-18-21-17-20-13(2)12-24-17/h4-10,12H,3,11H2,1-2H3,(H,20,21) |
| InChIKey | QKCOCDCIXGXIAO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|