C20H19ClN4O5S2 — CID 16861904
1-(4-chlorophenyl)sulfonyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide (PubChem CID 16861904) has the molecular formula C20H19ClN4O5S2 and a molecular weight of 494.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16861904 |
| Molecular Formula | C20H19ClN4O5S2 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide |
| SMILES | Cn1/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccc(Cl)cc3)C2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H19ClN4O5S2/c1-23-17-9-6-15(25(27)28)11-18(17)31-20(23)22-19(26)13-3-2-10-24(12-13)32(29,30)16-7-4-14(21)5-8-16/h4-9,11,13H,2-3,10,12H2,1H3/b22-20- |
| InChIKey | YAAMESGLUYSOOB-XDOYNYLZSA-N |
| XLogP | 3.33 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|