About 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid
2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid (PubChem CID 168619625) has the molecular formula C12H10FN3O2S
and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid.
Molecular Properties
| Compound Name | 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid |
| PubChem CID | 168619625 |
| Molecular Formula | C12H10FN3O2S |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1csc(NN=Cc2cccc(F)c2C(=O)O)n1 |
| InChI | InChI=1S/C12H10FN3O2S/c1-7-6-19-12(15-7)16-14-5-8-3-2-4-9(13)10(8)11(17)18/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | ZNKUVCLZHYQZCB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid?
The IUPAC name of 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid (CID 168619625) is 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid.
What is the SMILES notation for 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid?
The canonical SMILES for 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid is Cc1csc(NN=Cc2cccc(F)c2C(=O)O)n1.
What is the InChIKey of 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid?
The InChIKey is ZNKUVCLZHYQZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FN3O2S/c1-7-6-19-12(15-7)16-14-5-8-3-2-4-9(13)10(8)11(17)18/h2-6H,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid?
2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid has a molecular weight of 279.30 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid is sourced from PubChem (CID 168619625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).