C16H17N3O6S — CID 168620144
2-[2-[[3-(2-ethoxy-2-oxoethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620144) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-[2-[[3-(2-ethoxy-2-oxoethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3-(2-ethoxy-2-oxoethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620144 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-[2-[[3-(2-ethoxy-2-oxoethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOC(=O)COc1cccc(C=NN=C2NC(=O)C(CC(=O)O)S2)c1 |
| InChI | InChI=1S/C16H17N3O6S/c1-2-24-14(22)9-25-11-5-3-4-10(6-11)8-17-19-16-18-15(23)12(26-16)7-13(20)21/h3-6,8,12H,2,7,9H2,1H3,(H,20,21)(H,18,19,23) |
| InChIKey | CWOAWWLYHDSPHF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|