C18H15N3O5S2 — CID 168620734
2-[2-[[2-(benzenesulfonyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620734) has the molecular formula C18H15N3O5S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[2-[[2-(benzenesulfonyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[2-(benzenesulfonyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620734 |
| Molecular Formula | C18H15N3O5S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-[2-[[2-(benzenesulfonyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccccc2S(=O)(=O)c2ccccc2)NC1=O |
| InChI | InChI=1S/C18H15N3O5S2/c22-16(23)10-14-17(24)20-18(27-14)21-19-11-12-6-4-5-9-15(12)28(25,26)13-7-2-1-3-8-13/h1-9,11,14H,10H2,(H,22,23)(H,20,21,24) |
| InChIKey | NQCOSPAPBJCIHU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|