C18H13F3N4O4S — CID 168622308
2-[4-oxo-2-[[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622308) has the molecular formula C18H13F3N4O4S and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-[4-oxo-2-[[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-[[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622308 |
| Molecular Formula | C18H13F3N4O4S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-[4-oxo-2-[[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(Oc3cccc(C(F)(F)F)n3)cc2)NC1=O |
| InChI | InChI=1S/C18H13F3N4O4S/c19-18(20,21)13-2-1-3-14(23-13)29-11-6-4-10(5-7-11)9-22-25-17-24-16(28)12(30-17)8-15(26)27/h1-7,9,12H,8H2,(H,26,27)(H,24,25,28) |
| InChIKey | WDGOARRTSNKVGY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|